| Supplier Name | |
| Tel | 0714-3293168-6022 |
| Mobile | 15172040684 |
| info@fuertaichem.com | |
| Website | http:// |
| Product Name | Chloromethyl isopropyl carbonate |
| Synonyms | CMIC CMIC,for Tenofovir L-Propylchloromethylcarbonate I-PROPYL CHLOROMETHYL CARBONATE Chloromethyl-2-propyl carbonate i-Propyl Chloromethyl Carbonate Chloromethyl-2-propyl Carbonate |
| CAS | 35180-01-9 |
| EINECS | 1308068-626-2 |
| Chemical Formula | C5H9ClO3 |
| Molecular Weight | 152.58 |
| inchi | InChI=1/C5H9ClO3/c1-4(2)9-5(7)8-3-6/h4H,3H2,1-2H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |