![]() | |
Supplier Name | |
Tel | 010-50973130 |
Mobile | 17801761073(微信同号) |
3193328036@qq.com | |
Website | http://solarbio.com |
17801761073 |
Product Name | polymyxin B standard solution |
Synonyms | POLYMYXIN B Polymyxin B (PMB) POLYMYXIN B (PMB) Polymyxin B sulfate POLYMYXIN B SULFATE POLYMIXIN B SULFATE Polymyxin B Sulphate |
CAS | 1405-20-5 |
EINECS | 215-774-7 |
Chemical Formula | C56H100N16O17S |
Molecular Weight | 1301.56 |
inchi | InChI=1/C48H82N16O13.H2O4S/c1-27(2)24-37-47(76)59-32(11-19-52)41(70)56-31(10-18-51)43(72)61-35(14-22-65)39(68)54-21-13-34(45(74)57-33(12-20-53)44(73)64-38(48(77)63-37)25-28-6-4-3-5-7-28)60-42(71)30(9-17-50)58-46(75)36(15-23-66)62-40(69)29(8-16-49)55-26-67 |
Package | Email to quote |
Price | Email to quote |
Descriptions | |
Last Update | 2025-04-23 13:10:36 |