Product Name | N,N-Dimethylaminoethyl acrylate |
Synonyms | DA DAA ADAME DMAEA Dimethylaminoethyl Acrylate 2-(Dimethylamino)ethyl acrylate N,N-Dimethylaminoethyl acrylate |
CAS | 2439-35-2 |
EINECS | 219-460-0 |
Chemical Formula | C7H13NO2 |
Molecular Weight | 143.18 |
inchi | InChI=1/C9H10ClNO2/c1-13-9(12)8(11)6-4-2-3-5-7(6)10/h2-5,8H,11H2,1H3 |
Package | 200KG/Drum |
Price | RFQ |
Descriptions | 2- (Dimethylamino) ethyl acrylate is an organic compound with the molecular formula C7H11NO2. It is synthesized by reacting methyl acrylate with N, N-dimethylaminoethanol and is commonly used as a chemical reagent, pharmaceutical intermediate, and material intermediate. Dimethylaminoethyl acrylate has the following characteristics: 1. Chemical properties: Dimethylaminoethyl acrylate is an organic compound containing unsaturated double bonds, therefore it has certain reactivity. It can undergo reactions such as esterification, acylation, and amination. 2. Biological activity: Dimethylaminoethyl acrylate has certain biological activity and can be used as a pharmaceutical intermediate. It can be used to synthesize drugs with antibacterial, antiviral, anti-tumor and other effects. 3. Material application: Dimethylaminoethyl acrylate can also be used as an intermediate in the synthesis of polymer materials, such as polymers, resins, etc. These polymer materials have excellent physical and chemical properties and can be used to manufacture products such as plastics, coatings, adhesives, etc. 4. Safety and environmental protection: Dimethylaminoethyl acrylate should follow relevant safety regulations during production and use to avoid harm to human health and the environment. In summary, dimethylaminoethyl acrylate is an organic compound with broad application prospects, which can be used in fields such as medicine and materials. In practical applications, attention should be paid to its safety and environmental performance to ensure the rational and efficient utilization of resources. |
Last Update | 2024-11-05 09:57:44 |