Product Name | (R)-(+)-N-Benzyl-alpha-methylbenzylamine |
Synonyms | (R)-(+)-N-Benzyl- R(+)-N-benzyl-a-phen N-Benzyl-1-phenylethanamine R-Benzyl-α-methylbenzylamine (R)-(+)-N-Benzyl-1-phenylethylamine (R)-(+)-N-Benzyl-alpha-methylbenzylamine (1R)-N-(cyclohexylmethyl)-1-phenylethanaminium |
CAS | 38235-77-7 |
EINECS | 609-537-0 |
Chemical Formula | C15H17N |
Molecular Weight | 211.3 |
inchi | InChI=1/C15H23N/c1-13(15-10-6-3-7-11-15)16-12-14-8-4-2-5-9-14/h3,6-7,10-11,13-14,16H,2,4-5,8-9,12H2,1H3/p+1/t13-/m1/s1 |
Package | 200kg/Drum |
Price | RFQ |
Descriptions | The physical properties of R-(+)-N-Benzyl-1-phenylethylamine are as follows: colorless to light yellow liquid, boiling point 195-197 ° C, density 1.04 g/cm ³, refractive index 1.576-1.580. This compound has an irritating odor and is easily soluble in organic solvents such as ethanol, acetone, chloroform, etc. Its solubility in water is poor. |
Last Update | 2024-11-05 09:57:44 |