Product Name | alpha-methyl-benzenepropanamine |
Synonyms | AURORA KA-7110 dl-amphetamine DL-AMPHETAMINE aurora ka-7110 4-phenyl-2-aminobutane 1-phenyl-3-aminobutane 3-amino-1-phenylbutane |
CAS | 22374-89-6 |
EINECS | 244-942-2 |
Chemical Formula | C10H15N |
Molecular Weight | 149.24 |
inchi | InChI=1/C10H15N/c1-9(11)7-8-10-5-3-2-4-6-10/h2-6,9H,7-8,11H2,1H3/p+1/t9-/m0/s1 |
Package | 1kg、25kg |
Price | By E-mail |
Descriptions | 1-methyl-3-phenylpropylamine is a colorless transparent liquid at room temperature and pressure, with a certain alkalinity. It can combine with common acidic substances to form salts, including corresponding hydrochloride salts, sulfates, etc. 1-methyl-3-phenylpropylamine can be used as an intermediate in organic synthesis and pharmaceutical chemistry, and is often used for structural modification and synthesis of drug molecules and bioactive molecules. For example, this substance can be used for the synthesis of the drug molecule sulfamethoxazole. |
Last Update | 2024-11-05 09:57:44 |