![]() | |
Supplier Name | BOC Sciences |
Contact | Linna Green |
Tel | +16314854226 |
Mobile | +16314854226 |
info@bocsci.com | |
Website | https://www.bocsci.com/ |
https://www.linkedin.com/company/boc-sciences |
Product Name | methyl-B-D-ribofuranoside |
Synonyms | 1-OME-BETA-D-RIB methyl pentofuranoside Methyl--D-ribofuranoside methyl-B-D-ribofuranoside METHYL B-D-RIBOFURANOSIDE METHYL-SS-D-RIBOFURANOSIDE METHYL BETA-D-RIBOFURANOSIDE |
CAS | 7473-45-2 |
EINECS | 231-271-5 |
Chemical Formula | C6H12O5 |
Molecular Weight | 164.16 |
inchi | InChI=1/C6H12O5/c1-10-6-5(9)4(8)3(2-7)11-6/h3-9H,2H2,1H3 |
Package | 50 g |
Price | $298 |
Descriptions | Methyl b-D-ribofuranoside Methyl b-D-ribofuranoside, a widely employed biomedical product in research and diagnostics, stands as a synthetic sugar compound intricately resembling a crucial fragment of both RNA and DNA. Its application extends to exploring the repercussions of nucleotide alterations and serving as a standard compound in nucleic acid synthesis. Moreover, its usage exhibits promise in antiviral drug development and unraveling intricate cellular mechanisms entailing nucleic acids. |
Supplier Website | https://www.bocsci.com/product/methyl-b-d-ribofuranoside-cas-7473-45-2-76364.html |
Last Update | 2025-04-30 11:27:47 |