![]() | |
Supplier Name | BOC Sciences |
Contact | Linna Green |
Tel | +16314854226 |
Mobile | +16314854226 |
info@bocsci.com | |
Website | https://www.bocsci.com/ |
https://www.linkedin.com/company/boc-sciences |
Product Name | hygromycin B solution from streptomyces hygroscopicus |
Synonyms | Hygromix hygromix-8 hygromix2.4 hygrovetine hydromycinb Hygromycin B antihelmycin |
CAS | 31282-04-9 |
EINECS | 250-545-5 |
Chemical Formula | C20H37N3O13 |
Molecular Weight | 527.52 |
inchi | InChI=1/C20H37N3O13/c1-23-7-2-5(21)9(26)15(10(7)27)33-19-17-16(11(28)8(4-25)32-19)35-20(36-17)18(31)13(30)12(29)14(34-20)6(22)3-24/h5-19,23-31H,2-4,21-22H2,1H3/t5-,6?,7+,8-,9+,10-,11+,12-,13+,14-,15-,16+,17+,18-,19+,20?/m1/s1 |
Package | 5 g |
Price | $397 |
Descriptions | Hygromycin B Hygromycin B is an aminoglycoside antibiotic produced by Streptomyces hygroscopicus, Str. noboritoensis and Corynebacterium sp. It has anti-gram-positive bacteria, negative bacteria, mycobacteria, amoeba, spirochetes and anthelmintic effects. |
Supplier Website | https://bio-fermen.bocsci.com/product/hygromycin-b-cas-31282-04-9-65797.html |
Last Update | 2025-04-30 11:27:47 |