Request for quotation
Supplier Contact
 | |
| Supplier Name | BOC Sciences |
| Contact | Linna Green |
| Tel | +16314854226 |
| Mobile | +16314854226 |
| info@bocsci.com | |
| Website | https://www.bocsci.com/ |
| https://www.linkedin.com/company/boc-sciences | |
| Product Name | minoxidil sulfate |
| Synonyms | U-58838 MINOXIDIL SULFATE minoxidil sulfate MINOXIDIL SULPHATE Minoxidil, Sulfate minoxidilsulfateester Minoxidil Sulfate Salt |
| CAS | 83701-22-8 |
| EINECS | 635-997-7 |
| Chemical Formula | C9H15N5O4S |
| Molecular Weight | 289.31 |
| inchi | InChI=1/C9H15N5O.H2O4S/c10-7-6-8(12-9(11)14(7)15)13-4-2-1-3-5-13;1-5(2,3)4/h6H,1-5,10H2,(H2,11,12);(H2,1,2,3,4) |
| Package | 100 g |
| Price | $439 |
| Descriptions | Minoxidil Sulfate Minoxidil sulfate is the active metabolite of Minoxidil and it is a potent vascular smooth muscle relaxant. Minoxidil sulfate is a selective ATP-sensitive potassium channel opener. |
| Supplier Website | https://www.bocsci.com/minoxidil-sulfate-cas-83701-22-8-item-78174.html |
| Last Update | 2025-04-30 11:27:47 |