| Supplier Name | |
| Tel | 15954734980 |
| Mobile | 15954734980 |
| 343896208@qq.com | |
| Website | http:// |
| Product Name | Heptanoyl chloride |
| Synonyms | anthic chloride Enanthic chloride ENANTHIC CHLORIDE Heptanoyl chloride Oenanthic chloride HEPTANOYL CHLORIDE n-hetanoyl chloride |
| CAS | 2528-61-2 |
| EINECS | 219-775-3 |
| Chemical Formula | C7H13ClO |
| Molecular Weight | 148.63 |
| inchi | InChI=1/C7H13ClO/c1-2-3-4-5-6-7(8)9/h2-6H2,1H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |