| Supplier Name | |
| Tel | 18405177585 |
| Mobile | |
| monomers@126.com | |
| Website | http://https://www.rendachem.com/ |
| Product Name | methacrylic anhydride |
| Synonyms | methacrylic anhydride Methacryloyl anhydride methacrylicacidanhydride 1-Methylacrylic anhydride Methacrylic acid anhydride Methylacrylic acid anhydride 2-methylprop-2-enoic anhydride |
| CAS | 760-93-0 |
| EINECS | 212-084-8 |
| Chemical Formula | C8H10O3 |
| Molecular Weight | 154.17 |
| inchi | InChI=1/C8H10O3/c1-5(2)7(9)11-8(10)6(3)4/h1,3H2,2,4H3 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2023-04-27 18:30:20 |