| Supplier Name | |
| Tel | |
| Mobile | 13406988070 |
| m13406988070@163.com | |
| Website | https://shop0656235jg9p72.1688.com/ |
| Product Name | Potassium sorbate |
| Synonyms | Potassium sorbate Potassium sarbate SORBIC ACID K SALT potassiumsorbate(e) 2,4-Potassium Sorbate potassiumsalt,(e,e)-sorbicaci 2,4-potassium hexadienoic acid |
| CAS | 24634-61-5;590-00-1 |
| EINECS | 246-376-1 |
| Chemical Formula | C6H7KO2 |
| Molecular Weight | 150.22 |
| inchi | InChI=1/C6H8O2.K/c1-2-3-4-5-6(7)8;/h2-5H,1H3,(H,7,8);/q;+1/p-1/b3-2-,5-4- |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Last Update | 2023-04-27 18:30:20 |