| Supplier Name | |
| Tel | +8615791378681 |
| Mobile | |
| sales02@chemfish.com | |
| Website | http://www.chemfish.com |
| Product Name | 4,4'-dibromodiphenyl ether |
| Synonyms | PBDE 15(4.4' BIS(P-BROMOPHENYL)ETHER DI-(P-BROMOPHENYL)ETHER bis(p-bromophenyl) ether BIS(4-BROMOPHENYL) ETHER Bis-(4-bromphenyl)-ether Bis(4-Bromophenyl) Ether |
| CAS | 2050-47-7 |
| EINECS | 218-090-7 |
| Chemical Formula | C12H8Br2O |
| Molecular Weight | 328 |
| inchi | InChI=1/C12H8Br2O/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8H |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |