| Supplier Name | Zhejiang Xianju Junye Pharmaceutical Co., Ltd |
| Tel | 0576-87821302 |
| Mobile | 15168672352 |
| yashon313@gmail.com | |
| Website | http://www.junyepharm.com |
| Product Name | β-estradiol |
| Synonyms | Estradiol B-estradiol β-estradiol Beta-Estradiol 17beta-Estradiol 17beta-estradiol Dihydrofolliculin |
| CAS | 50-28-2 |
| EINECS | 200-023-8 |
| Chemical Formula | C18H24O2 |
| Molecular Weight | 272.39 |
| inchi | InChI=1/C18H24O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h3,5,10,14-17,19-20H,2,4,6-9H2,1H3/t14-,15-,16+,17+,18+/m0/s1 |
| Package | Email to quote |
| Price | Email to quote |
| Descriptions | |
| Supplier Website | |
| Last Update | 2023-04-27 18:30:20 |