| Name | (-+)-sulfinpyrazone |
| Synonyms | SSB1 Nitrate SULFINPYRAZONE Sulfinpyrazone (+)-SULFINPYRAZONE (-+)-sulfinpyrazone SALOR-INT L129682-1EA sulfoxyphenyl pyrazolidine 1,2-DIPHENYL-4-(PHENYLSUFINYLETHYL)-3,5-PYRAZOLIDINEDIONE 1,2-DIPHENYL-4-[PHENYLSULFINYLETHYL]-3,5-PYRAZOLIDINEDIONE 1,2-diphenyl-4-(2-phenylsulphinylethyl)pyrazolidine-3,5-dione 1,2-diphenyl-4-[2-(phenylsulfinyl)ethyl]pyrazolidine-3,5-dione 1,2-diphenyl-4-(2-(phenylsulfinyl)ethyl)-3,5-pyrazolidinedione |
| CAS | 57-96-5 |
| EINECS | 200-357-4 |
| InChI | InChI=1/C23H20N2O3S/c26-22-21(16-17-29(28)20-14-8-3-9-15-20)23(27)25(19-12-6-2-7-13-19)24(22)18-10-4-1-5-11-18/h1-15,21H,16-17H2 |
| Molecular Formula | C23H20N2O3S |
| Molar Mass | 404.48 |
| Density | 1.1890 (rough estimate) |
| Melting Point | 136-137° |
| Boling Point | 590.8±42.0 °C(Predicted) |
| Flash Point | 311.1°C |
| Water Solubility | 2.601g/L(22 ºC) |
| Solubility | Very slightly soluble in water, sparingly soluble in ethanol (96 per cent). It dissolves in dilute solutions of alkali hydroxides. |
| Vapor Presure | 6.2E-14mmHg at 25°C |
| Appearance | neat |
| Color | Off-White to Light Brown |
| pKa | pKa 2.8(H2Ot = RTI undefined) (Uncertain) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.6360 (estimate) |
| Use | Used as an anti-gout drug |
| In vitro study | Sulfinpyrazone (G-28315) stimulates fibrinolytic activity. |
| In vivo study | Sulfinpyrazone exerts its significant electrophysiological activity under a variety of different experimental conditions. It can increase the ventricular fibrillation threshold and mid-diastolic threshold and prolong the effective refractory period. In severely ischemic hearts, sulfinpyrazone attenuates the effect of myocardial infarction on ventricular fibrillation threshold, but has no effect after ischemia-reperfusion. In the sympathohumoral stimulation of noradrenaline, sulfinpyrazone has a significant protective effect. |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 22 - Harmful if swallowed |
| Safety Description | 36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| RTECS | UQ8575000 |
| HS Code | 2933194350 |