| Name | Phthalocyanine Blue Bsx |
| Synonyms | CI 26380 C.I. 74250 FAST BLUE BNS FAST BLUE PHBS CYANINE BLUE G CYANINE BLUE B SULFONCYANINE BLUE G Phthalocyanine Blue Bsx copper chlorophthalocyanine pigment blue 0.626388888888889 Pigment Phthalocyanine Blue BSX Copper monochlorophthalocyanine (CHLOROPHTHALOCYANINATO)COPPER(II) |
| CAS | 12239-87-1 |
| EINECS | 235-476-0 |
| InChI | InChI=1/C32H15ClN8.Cu/c33-23-15-7-14-22-24(23)32-40-30-21-13-6-5-12-20(21)28(38-30)36-26-17-9-2-1-8-16(17)25(34-26)35-27-18-10-3-4-11-19(18)29(37-27)39-31(22)41-32;/h1-15H;/q-2;+2/rC32H15ClCuN8/c33-23-15-7-14-22-24(23)32-40-28-19-11-4-3-10-18(19)26(36-28)38-30-21-13-6-5-12-20(21)29-37-25-16-8-1-2-9-17(16)27(35-25)39-31(22)42(32)34-41(29)30/h1-15H/b37-25-,37-29-,38-26-,38-30-,39-27-,39-31-,40-28-,40-32- |
| Molecular Formula | C32H17ClCuN8 |
| Molar Mass | 612.53 |
| Density | 1.62[at 20℃] |
| Physical and Chemical Properties | solubility: insoluble in water, ethanol and hydrocarbon solvents, in concentrated sulfuric acid olive-colored solution, diluted blue precipitation. hue or shade: bright red light blue density/(g/cm3):1.65 Bulk density/(lb/gal):11.8-15.0 melting point/℃:480 average particle size/μm:50 particle shape: Rod (square) specific surface area/(m2/g):53-92 pH value/(10% slurry):6.0-9.0 oil absorption/(g/100g):30-80 hiding power: transparent diffraction curve: ![]() reflection curve: ![]() |
| Use | For plastics, rubber, coatings, etc. there are 178 kinds of commercial formulations of the pigment, some of which affect the color power and brightness, but it is a stable α-type CuPc, it has important commercial value, showing excellent solvent resistance, light and weather fastness, and surface modification to improve the fluidity. Widely used in automotive coatings, plastics, such as: polyamide, polyurethane foam, polystyrene and polycarbonate (thermal stability of 340 ℃) and printing ink (such as metal decorative ink can withstand 200 ℃/10min); in natural rubber coloring may be due to the presence of free copper, affect its vulcanization effect (free copper in CuPc does not exceed 0.015%). |
| LogP | -1 at 23℃ |
| EPA chemical substance information | information provided by: ofmpeb.epa.gov (external link) |
| Use | for plastics, rubber, paint, etc |