| Name | 1,1-diethoxycyclohexane |
| Synonyms | AKOS 61 RHUMACETAL 1,1-diethoxycyclohexane 1,1-diethoxy-cyclohexan 1,1-DIETHOXYCYCLOHEXANE 1,1-Diethoxycyclohexane 1,1-DIETHOXYCYCLOHEXANONE Cyclohexane, 1,1-diethoxy- CYCLOHEXANONE DIETHYL KETAL CYCLOHEXANONE DIETHYL ACETAL Cyclohexanone diethyl acetal |
| CAS | 1670-47-9 |
| EINECS | 216-798-0 |
| InChI | InChI=1/C10H20O2/c1-3-11-10(12-4-2)8-6-5-7-9-10/h3-9H2,1-2H3 |
| Molecular Formula | C10H20O2 |
| Molar Mass | 172.26 |
| Density | 0.908g/mLat 25°C(lit.) |
| Boling Point | 76-78°C20mm Hg(lit.) |
| Flash Point | 140°F |
| JECFA Number | 2051 |
| Vapor Presure | 0.341mmHg at 25°C |
| BRN | 1851801 |
| Storage Condition | 2-8℃ |
| Refractive Index | n20/D 1.4360(lit.) |
| MDL | MFCD00037723 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | UN 1993 3/PG 3 |
| WGK Germany | 2 |
| TSCA | Yes |
| Hazard Class | 3 |
| FEMA | 4516 | CYCLOHEXANONE DIETHYL KETAL |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |