| Name | 1-bromo-3,5-diphenylbenzene |
| Synonyms | M-DPPBr 5'-BroMo-M-terphenyl 3',5'-Diphenylbromobenzene 1-BroMo-3,5-diphenylbenzen 1-Bromo-3,5-diphenylbenzene 1-bromo-3,5-diphenylbenzene 1,3-diphenyl-5-broMobenzene (3,5-Diphenylphenyl) broMo benzene |
| CAS | 103068-20-8 |
| EINECS | 822-230-8 |
| InChI | InChI=1S/C18H13Br/c19-18-12-16(14-7-3-1-4-8-14)11-17(13-18)15-9-5-2-6-10-15/h1-13H |
| Molecular Formula | C18H13Br |
| Molar Mass | 309.2 |
| Density | 1.309 |
| Melting Point | 105-106℃ |
| Boling Point | 401.1±14.0 °C(Predicted) |
| Flash Point | 192.162 °C |
| Appearance | powder to crystal |
| Color | White to Almost white |
| Maximum wavelength(λmax) | ['252nm(CH2Cl2)(lit.)'] |
| Storage Condition | Sealed in dry,Room Temperature |
| MDL | MFCD00196170 |
| UN IDs | UN 3152 9/PG II |
| Hazard Class | 9 |
| Packing Group | II |
| use | 1-bromo -3,5 diphenylbenzene is used as an organic and pharmaceutical intermediate. |