| Name | 1-Acetyl-5-nitroindoline |
| Synonyms | 1-Acetyl-5-nitroindoline 1-ACETYL-5-NITROINDOLINE 1-Acetoxy-5-Nitroindoline 1-(5-nitro-1-indolinyl)ethanone 1-(5-Nitro-indoline-1-yl)ethanone 1-Acetyl-2,3-dihydro-5-nitro-1H-indole 1-(5-nitro-2,3-dihydroindol-1-yl)ethanone 1-(5-Nitro-2,3-dihydro-1H-indol-1-yl)ethan-1-one, TECH |
| CAS | 33632-27-8 |
| EINECS | 251-609-5 |
| InChI | InChI=1/C10H10N2O3/c1-7(13)11-5-4-8-6-9(12(14)15)2-3-10(8)11/h2-3,6H,4-5H2,1H3 |
| Molecular Formula | C10H10N2O3 |
| Molar Mass | 206.2 |
| Density | 1.2815 (rough estimate) |
| Melting Point | 175-176°C(lit.) |
| Boling Point | 345.04°C (rough estimate) |
| Flash Point | 235.9°C |
| Vapor Presure | 7.1E-09mmHg at 25°C |
| pKa | -3.28±0.20(Predicted) |
| Storage Condition | Refrigerator (+4°C) |
| Refractive Index | 1.6300 (estimate) |
| MDL | MFCD00005811 |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| RTECS | NM1892800 |
| TSCA | Yes |
| HS Code | 29339900 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |