| Name | 1-Chlorocarbonyl-2-imidazolidone |
| Synonyms | TIMTEC-BB SBB004082 1-Chlorocarbonyl-2-Imidazolidone 1-Chlorocarbonyl-2-imidazolidone 1-CHLOROCARBONYL-2-IMIDAZOLIDINONE N-CHLOROCARBONYL-2-IMIDAZOLIDINONE 1-Chloroformylimidazolidinyl-2-one 2-oxo-1-imidazolidinecarbonyl chloride 2-OXO-1-IMIDAZOLIDINECARBONYL CHLORIDE 2-oxoimidazolidine-1-carbonyl chloride 2-OXO-IMIDAZOLIDINE-1-CARBONYL CHLORIDE 1-Imidazolidinecarbonyl chloride, 2-oxo- (7CI,8CI,9CI) |
| CAS | 13214-53-4 |
| EINECS | 236-185-1 |
| InChI | InChI=1/C4H5ClN2O2/c5-3(8)7-2-1-6-4(7)9/h1-2H2,(H,6,9) |
| InChIKey | NXJZQSRAFBHNLI-UHFFFAOYSA-N |
| Molecular Formula | C4H5ClN2O2 |
| Molar Mass | 148.55 |
| Density | 1.509±0.06 g/cm3(Predicted) |
| Melting Point | 147-151°C(lit.) |
| Appearance | White crystalline powder |
| pKa | 12.62±0.20(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.527 |
| MDL | MFCD02683529 |
| Use | An important pharmaceutical intermediate, mainly used in the synthesis of drugs such as Azlocillin |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| Hazard Class | IRRITANT |
| uses | an important pharmaceutical intermediate, mainly used in the synthesis of drugs such as azlocillin pharmaceutical intermediates, mainly used in the synthesis of azlocillin. |