| Name | 1-Phenyl-1-cyclohexene |
| Synonyms | 1-phenyl-cyclohexen 1-PHENYLCYCLOHEXENE 1-PHENYLCYCLOHEXANE 1-Phenylcyclohexene Phenyl-1-cyclohexene Cyclohexene, 1-phenyl- 1-phenylcyclohex-1-ene 1-Phenyl-1-cyclohexene 1-PHENYL-1-CYCLOHEXENE 1-CYCLOHEXEN-1-YLBENZENE cyclohex-1-en-1-ylbenzene 1-Cyclohexenylbenzene~2,3,4,5-Tetrahydrobiphenyl |
| CAS | 771-98-2 |
| EINECS | 212-242-6 |
| InChI | InChI=1/C12H14/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1,3-4,7-9H,2,5-6,10H2 |
| InChIKey | WCMSFBRREKZZFL-UHFFFAOYSA-N |
| Molecular Formula | C12H14 |
| Molar Mass | 158.24 |
| Density | 0.994 g/mL at 25 °C (lit.) |
| Melting Point | -11 °C (lit.) |
| Boling Point | 251-253 °C (lit.) |
| Flash Point | 218°F |
| Water Solubility | Insoluble in water. |
| Solubility | Chloroform, DMSO, Ethyl Acetate |
| Vapor Presure | 0.0315mmHg at 25°C |
| Appearance | Liquid |
| Specific Gravity | 0.99 |
| Color | Clear colorless to light yellow |
| BRN | 1905772 |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | n20/D 1.57(lit.) |
| MDL | MFCD00001542 |
| Hazard Symbols | F - Flammable![]() |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| RTECS | GW6600000 |
| HS Code | 29029090 |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |