| Name | 4-bromo-3-nitroanisole |
| Synonyms | TIMTEC-BB SBB009974 4-bromo-3-nitroanisole 3-Nitro-4-brom-thioanisol 4-BROMO-3-NITROTHIOANISOLE 1-broMo-4-Methoxy-2-nitrobenzen 1-bromo-4-methoxy-2-nitrobenzene Benzene, 1-bromo-4-(methylthio)-2-nitro- |
| CAS | 10079-53-5 5344-78-5 |
| EINECS | 226-290-0 |
| InChI | InChI=1/C7H6BrNO3/c1-12-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
| Molecular Formula | C7H6BrNO2S |
| Molar Mass | 248.1 |
| Density | 1.70±0.1 g/cm3(Predicted) |
| Melting Point | 32-34°C(lit.) |
| Boling Point | 153-154°C13mm Hg(lit.) |
| Flash Point | >230°F |
| Vapor Presure | 0.00349mmHg at 25°C |
| Appearance | Ash powder |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.581 |
| MDL | MFCD00051511 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| Hazard Class | IRRITANT |