| Name | 1-methylcyclopropanemethanol |
| Synonyms | 1-METHYLCYCLOPROPANEMETHANOL 1-methylcyclopropanemethanol 1-Methylcyclopropanemethanol (1-Methylcyclopropyl)methanol (1-methylcyclopropyl)methanol Cyclopropanemethanol,1-methyl- (1-Methylcyclopropyl)Methanol 2-chloro-5,6,7,8-tetrahydro-1,6-naphthyridine hydrochloride |
| CAS | 2746-14-7 |
| InChI | InChI=1/C5H10O/c1-5(4-6)2-3-5/h6H,2-4H2,1H3 |
| InChIKey | PIZQWRXTMGASCZ-UHFFFAOYSA-N |
| Molecular Formula | C5H10O |
| Molar Mass | 86.13 |
| Density | 0.887 g/mL at 25 °C (lit.) |
| Melting Point | -15.1°C |
| Boling Point | 128 °C/750 mmHg (lit.) |
| Flash Point | 93°F |
| Vapor Presure | 4.84mmHg at 25°C |
| Storage Condition | -20℃ |
| Refractive Index | n20/D 1.431(lit.) |
| Risk Codes | 10 - Flammable |
| Safety Description | S16 - Keep away from sources of ignition. S29 - Do not empty into drains. S33 - Take precautionary measures against static discharges. |
| UN IDs | UN 1987 3/PG 3 |
| WGK Germany | 3 |
| Hazard Class | 3.2 |
| Packing Group | III |
| overview | 1-methylcyclopropane methanol is an alcohol organic substance and can be used as an organic intermediate. |
| preparation | 1-methylcyclopropane methanol is an alcoholic organic substance, which can be prepared from 1-methylcyclopropane carboxylic acid in one step. |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |