| Name | 4,4'-Stilbenedicarboxylic acid |
| Synonyms | TIMTEC-BB SBB007944 4,4-Stilbenedicaroxylic acid 4,4'-stibenedicarboxylic acid 4,4'-Stilbenedicarboxylic acid 4,4'-STILBENEDICARBOXYLIC ACID 4,4'-STILBEN DICARBOXYLIC ACID 4,4'' SILBENE DICARBOXYLIC ACID 4,4'-ethene-1,2-diyldibenzoic acid 4,4'-(E)-ethene-1,2-diyldibenzoate 4,4'-(E)-ethene-1,2-diyldibenzoic acid 4,4'-Diphenylethylenedicarboxylic acid 4,4'-Diphenylethylene-Bicardoxylic Acid TRANS-4,4'-STIBENE-4,4'-DICARBOXYLIC ACID TRANS-4,4'-STILBENE-4,4'-DICARBOXYLIC ACID |
| CAS | 100-31-2 |
| EINECS | 202-838-4 |
| InChI | InChI=1/C16H12O4/c17-15(18)13-7-3-11(4-8-13)1-2-12-5-9-14(10-6-12)16(19)20/h1-10H,(H,17,18)(H,19,20)/p-2/b2-1+ |
| InChIKey | SBBQDUFLZGOASY-OWOJBTEDSA-N |
| Molecular Formula | C16H12O4 |
| Molar Mass | 268.26 |
| Density | 1.356±0.06 g/cm3(Predicted) |
| Melting Point | >300°C |
| Boling Point | 518.5±39.0 °C(Predicted) |
| Flash Point | 281.4°C |
| Vapor Presure | 1.42E-11mmHg at 25°C |
| Appearance | White to yellow powder |
| Color | White to Orange to Green |
| pKa | 3.96±0.10(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| MDL | MFCD00013994 |
| Use | Mainly used for the production of fluorescent whitening agent OB-1 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R52 - Harmful to aquatic organisms R38 - Irritating to the skin R37 - Irritating to the respiratory system R36 - Irritating to the eyes R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37 - Wear suitable gloves. |
| WGK Germany | 3 |
| use | mainly used to produce fluorescent whitening agent OB-1 used to synthesize plastic whitening agent and polymer intermediate. |