| Name | 3-(Acetylamino)-3-(4-Nitrophenyl)Propanoic Acid |
| Synonyms | 3-Acetamido-3-(4-nitrophenyl)propanoic acid 3-ACETYLAMINO-3-(4-NITRO-PHENYL)-PROPIONIC ACID Benzenepropanoic acid, β-(acetylamino)-4-nitro- 3-Acetylamino-3-(4-Nitro-Phenyl)-Propionic Acid 3-(ACETYLAMINO)-3-(4-NITROPHENYL)PROPANOIC ACID 3-(Acetylamino)-3-(4-Nitrophenyl)Propanoic Acid |
| CAS | 100061-23-2 |
| InChI | InChI=1/C11H12N2O5/c1-7(14)12-10(6-11(15)16)8-2-4-9(5-3-8)13(17)18/h2-5,10H,6H2,1H3,(H,12,14)(H,15,16) |
| Molecular Formula | C11H12N2O5 |
| Molar Mass | 252.22 |
| Density | 1.363g/cm3 |
| Boling Point | 545.9°C at 760 mmHg |
| Flash Point | 283.9°C |
| Vapor Presure | 9.47E-13mmHg at 25°C |
| Storage Condition | 2-8°C |
| Refractive Index | 1.578 |
| Hazard Symbols | Xi - Irritant![]() |
| Hazard Note | Irritant |
3-Acetamido-3-p-nitrophenyl-propionic acid (abbreviated as ANP) is an organic compound with the chemical formula C11H12N2O5. The following is a description of the nature, use, formulation and safety information of ANP:
Nature:
1. Appearance: ANP is white or light yellow crystalline powder.
2. Solubility: Soluble in organic solvents such as chloroform, acetone and ethanol, insoluble in water.
Preparation Method:
ANP can be obtained by reacting p-nitroacetophenone with ethanolamine. The specific preparation steps are as follows:
1. Add p-nitroacetophenone and ethanolamine to the reaction flask at a molar ratio of 1:1.
2. The reaction is carried out under appropriate temperature conditions, and acidic or alkaline catalysts are commonly used.
3. After completion of the reaction, the ANP product was obtained by filtration or crystallization.
Safety Information:
1. ANP is an organic nitrate compound, which is explosive and irritating. Please pay attention to prevent it from being exposed to open fire, high temperature and irritants.
2. Wear appropriate protective equipment, such as gloves, face masks, and protective clothing, when using or preparing ANP.
3. ANP should be stored in a dry, sealed, cool place, away from fire and flammable materials.