| Name | 2,8-Dibromodibenzofuran |
| Synonyms | 2,8-dibromo- 2,8-Dibromodibenzofura 2,8-Dibromodibenzofuran 2,8-DIBROMODIBENZOFURAN 2,8-Dibrom-dibenzofuran 2,8-dibroMo dibeozofuran Dibenzofuran, 2,8-dibromo- ,8-Dibromodibenzo[b,d]furan 2,8-dibromodibenzo[b,d]furan |
| CAS | 10016-52-1 |
| InChI | InChI=1/C12H6Br2O/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11/h1-6H |
| Molecular Formula | C12H6Br2O |
| Molar Mass | 325.98 |
| Density | 1.886 |
| Melting Point | 226℃ |
| Boling Point | 396℃ |
| Flash Point | 193℃ |
| Vapor Presure | 4.01E-06mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Light yellow |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.738 |
| application | 2, 8-dibromodibenzofuran is an organic synthesis intermediate and a pharmaceutical intermediate, mainly used in the laboratory research and development process and chemical production process. |