| Name | 5-Bromo-1-methyl-1H-imidazole |
| Synonyms | 128978 5-Bromo-1-methyL 5-BROMO-N-METHYLIMIDAZOLE 5-BROMO-1-METHYLIMIDAZOLE 5-BROMO-1-METHYL-1H-IMIDAZOLE 5-Bromo-1-methyl-1H-imidazole 1H-Imidazole,5-bromo-1-methyl- |
| CAS | 1003-21-0 |
| InChI | InChI=1/C4H5BrN2/c1-7-3-6-2-4(7)5/h2-3H,1H3 |
| InChIKey | HATLLUIOEIXWGD-UHFFFAOYSA-N |
| Molecular Formula | C4H5BrN2 |
| Molar Mass | 161 |
| Density | 1.69±0.1 g/cm3(Predicted) |
| Melting Point | 40-44 °C (lit.) |
| Boling Point | 120°C 15mm |
| Flash Point | 180°F |
| Vapor Presure | 0.0106mmHg at 25°C |
| Appearance | White to yellow powder or crystal |
| pKa | 5.25±0.10(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.606 |
| MDL | MFCD01632218 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| UN IDs | UN 3335 |
| WGK Germany | 3 |
| HS Code | 29332900 |
| Hazard Note | Irritant/Keep Cold |