| Name | 4-Picoline-N-oxide |
| Synonyms | 4-Picoline-N-oxide 4-Picoline N-oxide PICOLINE-4-N-OXIDE 4-PICOLINE-N-OXIDE 4-Picoline, 1-oxide GAMMA-PICOLINE N-OXIDE 4-methyl-pyridin1-oxide 4-methylpyridine 1-oxide 4-Methylpyridine N-oxide γ-Methylpyridine N-oxide 4-METHYLPYRIDINE N-OXIDE 4-METHYLPYRIDINE 1-OXIDE N-OXIDE OF 4-METHYL PYRIDINE |
| CAS | 1003-67-4 |
| EINECS | 213-712-3 |
| InChI | InChI=1/C6H7NO/c1-6-2-4-7(8)5-3-6/h2-5H,1H3 |
| Molecular Formula | C6H7NO |
| Molar Mass | 109.13 |
| Density | 1.1143 (rough estimate) |
| Melting Point | 182-185°C(lit.) |
| Boling Point | 152°C 11mm |
| Flash Point | 149 °C |
| Water Solubility | soluble |
| Solubility | 1000g/l |
| Vapor Presure | 0.00692mmHg at 25°C |
| Appearance | White to brown powder or lumpy |
| Color | White to Light yellow to Light orange |
| BRN | 106329 |
| pKa | 1.38±0.10(Predicted) |
| PH | >7 (H2O, 25℃)Aqueous solution |
| Storage Condition | Store at +2°C to +8°C. |
| Sensitive | Hygroscopic |
| Refractive Index | 1.5180 (estimate) |
| MDL | MFCD00006210 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 1 |
| RTECS | UT5800000 |
| FLUKA BRAND F CODES | 3 |
| TSCA | Yes |
| HS Code | 29333999 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |