| Name | 4-(Imidazol-1-yl)phenol |
| Synonyms | P-(1-IMIDAZOLYL)PHENOL 4-(IMIDAZOL-1-YL)PHENO 4-(Imidazol-1-yl)phenol p-(Imidazol-1-yl) phenol 4-(1H-Imidazol-1-yl)phenol N-(4-HYDROXYPHENYL)IMIDAZOLE N-(4-Hydroxyphenyl)imidazole 1-(4-Hydroxyphenyl)-1H-imidazole 4-(Imidazol-1-yl)phenol1-(4'-hydroxyphen-1-yl)imadazole |
| CAS | 10041-02-8 |
| EINECS | 233-121-4 |
| InChI | InChI=1/C9H8N2O/c12-9-3-1-8(2-4-9)11-6-5-10-7-11/h1-7,12H |
| InChIKey | CYKCUAPYWQDIKR-UHFFFAOYSA-N |
| Molecular Formula | C9H8N2O |
| Molar Mass | 160.17 |
| Density | 1.1846 (rough estimate) |
| Melting Point | 204-206°C(lit.) |
| Boling Point | 286.07°C (rough estimate) |
| Flash Point | 165.9°C |
| Vapor Presure | 2.14E-05mmHg at 25°C |
| Appearance | Fine Crystalline Powder |
| Color | Light brown-gray to brown-beige |
| BRN | 509999 |
| pKa | 9.36±0.26(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.5570 (estimate) |
| MDL | MFCD00005281 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S22 - Do not breathe dust. |
| WGK Germany | 3 |
| HS Code | 29332990 |