| Name | 5-BROMO-3-METHYLINDOLE |
| Synonyms | NSC 79234 5-Bromoskatole 5-BROMO-3-METHYLINDOLE 3-Methyl-5-bromoindole 5-broMo-3-Methyl-indol- 5-Bromo-3-methyl-1H-indole 1H-Indole, 5-broMo-3-Methyl- |
| CAS | 10075-48-6 |
| InChI | InChI=1/C9H8BrN/c1-6-5-11-9-3-2-7(10)4-8(6)9/h2-5,11H,1H3 |
| Molecular Formula | C9H8BrN |
| Molar Mass | 210.07 |
| Density | 1.563 |
| Melting Point | 78-82°C |
| Boling Point | 325.1±22.0 °C(Predicted) |
| Flash Point | 150.4°C |
| Vapor Presure | 0.000446mmHg at 25°C |
| pKa | 16.34±0.30(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.684 |
| Risk Codes | R22 - Harmful if swallowed R37/38 - Irritating to respiratory system and skin. R41 - Risk of serious damage to eyes |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S39 - Wear eye / face protection. |
| WGK Germany | 3 |
| Hazard Class | IRRITANT |