| Name | 3,5-DIIODO-4-PYRIDONE-1-ACETIC ACID |
| Synonyms | TIMTEC-BB SBB005882 3,5-DIIODO-4-PYRIDONE-N-ACETICCID 3,5-DIIODO-4-PYRIDONE-N-ACETIC ACID 3,5-DIIODO-4-PYRIDONE-1-ACETIC ACID 3,5-DIIODO-4-OXO-1(4H)-PYRIDINEACETIC ACID 3,5-DIIODO-4-HYDROXYPYRIDINE-N-ACETIC ACID (3,5-diiodo-4-oxopyridin-1(4H)-yl)acetic acid (3,5-DIIODO-4-OXO-4H-PYRIDIN-1-YL)-ACETIC ACID 1,4-dihydro-3,5-diiodo-4-oxo-1-pyridylacetic acid 1,4-DIHYDRO-3,5-DIIODO-4-OXO-1-PYRIDINEACETIC ACID |
| CAS | 101-29-1 |
| EINECS | 202-932-5 |
| InChI | InChI=1/C7H5I2NO3/c8-4-1-10(3-6(11)12)2-5(9)7(4)13/h1-2H,3H2,(H,11,12) |
| Molecular Formula | C7H5I2NO3 |
| Molar Mass | 404.93 |
| Density | 2.2000 (rough estimate) |
| Melting Point | 244°C (dec.) |
| Boling Point | 422.8±45.0 °C(Predicted) |
| Flash Point | 209.5°C |
| Water Solubility | 2.787g/L(temperature not stated) |
| Vapor Presure | 2.47E-08mmHg at 25°C |
| pKa | 3.60±0.10(Predicted) |
| Storage Condition | 2-8℃ |
| Sensitive | Light Sensitive |
| Refractive Index | 1.7400 (estimate) |
| MDL | MFCD00006185 |
| Physical and Chemical Properties | Sensitivity: Light Sensitive |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| Hazard Class | IRRITANT |
| Application | 3, 5-diiodo-4-pyridone -1-acetic acid is a carboxylic acid derivative, which can be used as an intermediate in organic synthesis. |