| Name | 1-(2,4-Dimethylphenyl)piperazine |
| Synonyms | AKOS BB-5739 TIMTEC-BB SBB003650 1-(2,4-Xylyl)piperazine 1-(2,4-xylyl)piperazine 4-DiMethylphenyl)piperazine 1-(2,4-Diemthylphenyl)Piperazine 1-(2,4-Dimethylphenyl)piperazine 1-(2,4-DIMETHYLPHENYL)PIPERAZINE 4-(2,4-dimethylphenyl)piperazin-1-ium |
| CAS | 1013-76-9 |
| EINECS | 213-797-7 |
| InChI | InChI=1/C12H18N2/c1-10-3-4-12(11(2)9-10)14-7-5-13-6-8-14/h3-4,9,13H,5-8H2,1-2H3/p+1 |
| Molecular Formula | C12H18N2 |
| Molar Mass | 190.28 |
| Density | 1.0130 |
| Boling Point | 153°C/10mmHg(lit.) |
| Flash Point | 152.2°C |
| Vapor Presure | 0.000139mmHg at 25°C |
| Appearance | Liquid |
| Color | Clear slightly colored |
| pKa | 9.00±0.10(Predicted) |
| Refractive Index | 1.553-1.555 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R36 - Irritating to the eyes |
| Safety Description | S24/25 - Avoid contact with skin and eyes. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| UN IDs | 3267 |
| HS Code | 29333990 |
| Hazard Class | 8 |
| Packing Group | III |