1017788-63-4
1-cbz-2-cyanopiperidine
CAS: 1017788-63-4
Molecular Formula: C14H16N2O2
1017788-63-4 - Names and Identifiers
| Name | 1-cbz-2-cyanopiperidine |
| Synonyms | N-CBZ-2-cyanopiperidine N-Cbz-2-cyanopiperidine 1-cbz-2-cyanopiperidine (S)-1-Cbz-2-cyanopiperidine Benzyl 2-cyano-1-piperidinecarboxylate Benzyl 2-cyanopiperidine-1-carboxylate 1-Piperidinecarboxylic acid, 2-cyano-, phenylmethyl ester |
| CAS | 1017788-63-4 |
| InChI | InChI=1S/C14H16N2O2/c15-10-13-8-4-5-9-16(13)14(17)18-11-12-6-2-1-3-7-12/h1-3,6-7,13H,4-5,8-9,11H2 |
1017788-63-4 - Physico-chemical Properties
| Molecular Formula | C14H16N2O2 |
| Molar Mass | 244.29 |
1017788-63-4 - Introduction
1-Cbz-2-cyanopiperidine is an organic compound, also known as N-protected cyanopiperidine. Its chemical formula is C18H16N2, and its structure contains a cyano group and an N-protecting group (usually a Carbobenzoxy group, abbreviated as Cbz).
Properties of 1-Cbz-2-cyanopiperidine:
1. Appearance: colorless or yellowish crystal.
2. melting point: about 110-115 ℃.
3. Solubility: Soluble in common organic solvents such as dimethyl sulfoxide (DMSO), chloroform and methanol.
Use of 1-Cbz-2-cyanopiperidine:
1. 1-Cbz-2-cyanopiperidine can be used as an important intermediate in organic synthesis, and is commonly used in the synthesis of various drugs, pesticides and chemical reagents.
2. It can also be used to synthesize biologically active compounds.
Preparation of 1-Cbz-2-cyanopiperidine:
1. The general preparation method involves reacting carbonyl chloride and piperidine in the presence of a base to obtain 1-Cbz-2-cyanopiperidine.
Safety information for 1-Cbz-2-Cyanopiperidine:
1. 1-Cbz-2-cyanopiperidine is an organic compound and should follow general laboratory practices.
2. Pay attention to prevent contact with skin and eyes during use, and ensure that the operation is carried out in a well-ventilated place.
3. in case of accidental contact, rinse immediately with plenty of water and seek medical help.
4. in the storage of 1-Cbz-2-cyanopiperidine, should be sealed in a dry, cool place, away from the fire and oxidant.
Properties of 1-Cbz-2-cyanopiperidine:
1. Appearance: colorless or yellowish crystal.
2. melting point: about 110-115 ℃.
3. Solubility: Soluble in common organic solvents such as dimethyl sulfoxide (DMSO), chloroform and methanol.
Use of 1-Cbz-2-cyanopiperidine:
1. 1-Cbz-2-cyanopiperidine can be used as an important intermediate in organic synthesis, and is commonly used in the synthesis of various drugs, pesticides and chemical reagents.
2. It can also be used to synthesize biologically active compounds.
Preparation of 1-Cbz-2-cyanopiperidine:
1. The general preparation method involves reacting carbonyl chloride and piperidine in the presence of a base to obtain 1-Cbz-2-cyanopiperidine.
Safety information for 1-Cbz-2-Cyanopiperidine:
1. 1-Cbz-2-cyanopiperidine is an organic compound and should follow general laboratory practices.
2. Pay attention to prevent contact with skin and eyes during use, and ensure that the operation is carried out in a well-ventilated place.
3. in case of accidental contact, rinse immediately with plenty of water and seek medical help.
4. in the storage of 1-Cbz-2-cyanopiperidine, should be sealed in a dry, cool place, away from the fire and oxidant.
Last Update：2024-04-09 15:17:50
Supplier List
View History
1017788-63-4
21656-02-0
1185292-58-3
23095-05-8
183483-09-2
透明蓝AP
1450933-18-2
67037-37-0
3973-17-9
barium diiodide
21656-02-0
1185292-58-3
23095-05-8
183483-09-2
透明蓝AP
1450933-18-2
67037-37-0
3973-17-9
barium diiodide