| Name | ETHYL 3-(3-CHLORO-2,4,5-TRIFLUOROPHENYL)-3-OXOPROPANOATE |
| Synonyms | Intermediate Of Sitafloxacin Ethyl 3-chloro-2,4,5-trifluorobenzoylacetate Ethyl 2-(3-chloro-2,4,5-trifluorobenzoyl)acetate 3-(3-chloro-2,4,5-trifluorophenyl)-3-oxopropanoic acid ETHYL 3-(3-CHLORO-2,4,5-TRIFLUOROPHENYL)-3-OXOPROPANOATE ethyl beta-(3-chloro-2,4,5-trifluorophenyl)-beta-oxopropionate Benzenepropanoic acid,3-chloro-2,4,5-trifluoro-b-oxo-, ethyl ester |
| CAS | 101987-86-4 |
| EINECS | 1806241-263-5 |
| InChI | InChI=1/C11H8ClF3O3/c1-2-18-8(17)4-7(16)5-3-6(13)11(15)9(12)10(5)14/h3H,2,4H2,1H3 |
| Molecular Formula | C11H8ClF3O3 |
| Molar Mass | 280.63 |
| Density | 1.413 |
| Melting Point | 80-83℃ |
| Boling Point | 325℃ |
| Flash Point | 130℃ |
| Vapor Presure | 0mmHg at 25°C |
| pKa | 10.32±0.50(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.484 |
| use | 3-chloro -2,4, 5-trifluorobenzoyl ethyl acetate is an ester derivative and can be used as an intermediate of citaxfloxacin. |