| Name | 9-(2'-ACETOXYETHOXYMETHYL)-GUANINE |
| Synonyms | Acyclovir IMpurity A Aciclovir impurity A (PhEur) Aciclovir Related Compound A (USP) 9-(2'-ACETOXYETHOXYMETHYL)-GUANINE 2-[(2-amino-6-oxo-3,6-dihydro-9H-purin-9-yl)methoxy]ethyl acetate 2-[(2-Amino-6-oxo-1,6-dihydro-9H-purin-9-yl)methoxy]ethyl acetate 9-[[2-(Acetyloxy)ethoxy]Methyl]-2-aMino-1,9-dihydro-6H-purin-6-one 6H-purin-6-one, 9-[[2-(acetyloxy)ethoxy]methyl]-2-amino-1,9-dihydro- Acyclovir Related Compound A (50 mg) (2-[(2-amino-6-oxo-1,6-dihydro-9H-purin-9-yl)methoxy]ethyl acetate) |
| CAS | 102728-64-3 |
| EINECS | 604-604-1 |
| InChI | InChI=1/C10H13N5O4/c1-6(16)19-3-2-18-5-15-4-12-7-8(15)13-10(11)14-9(7)17/h4H,2-3,5H2,1H3,(H3,11,13,14,17) |
| Molecular Formula | C10H13N5O4 |
| Molar Mass | 267.24 |
| Density | 1.61±0.1 g/cm3(Predicted) |
| Melting Point | 242-244°C (dec.) |
| Boling Point | 565.4°C at 760 mmHg |
| Flash Point | 295.7°C |
| Vapor Presure | 8.36E-13mmHg at 25°C |
| Appearance | neat |
| pKa | 9.34±0.20(Predicted) |
| Storage Condition | Refrigerator |
| Refractive Index | 1.686 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 68 - Possible risk of irreversible effects |
| Safety Description | 36/37 - Wear suitable protective clothing and gloves. |
| HS Code | 2933599550 |