| Name | 2-chloro-4-nitrophenyl-N-acetyl-beta-D-glucosaminide |
| Synonyms | CNP-NAG 2-Chloro-4-nitro-acetyl-β-D-glucosaminide -chloro-4-nitrophenyl-N-acetylglucosaMinide 2-Chloro-4-Nitrophenyl-N-Acetylglucosaminide 2-chloro-4-nitrophenyl-N-acetylglucosaminide 2-chloro-4-nitrophenyl-N-acetyl-β-D-glucosaminide 2-chloro-4-nitrophenyl-N-acetyl-β-D-glucosaMinide 2-Chloro-4-nitrophenyl-N-acetyl-bata-D-glucosaMinide 2-chloro-4-nitrophenyl-N-acetyl-beta-D-glucosaminide 2-Chloro-4-nitrophenyl 2-acetamido-2-deoxy-b-D-glucopyranoside 2-Chloro-4-nitrophenyl 2-(acetylamino)-2-deoxy-β-D-glucopyranoside 2-Chloro-4-nitrophenyl 2-(acetylamino)-2-deoxy-beta-D-glucopyranoside 2-chloro-4-nitrophenyl 2-(acetylamino)-2-deoxy-beta-D-glucopyranoside |
| CAS | 103614-82-0 |
| InChI | InChI=1/C14H17ClN2O8/c1-6(19)16-11-13(21)12(20)10(5-18)25-14(11)24-9-3-2-7(17(22)23)4-8(9)15/h2-4,10-14,18,20-21H,5H2,1H3,(H,16,19)/t10-,11-,12-,13-,14-/m1/s1 |
| Molecular Formula | C14H17ClN2O8 |
| Molar Mass | 376.75 |
| Density | 1.58 |
| Melting Point | 164-167°C |
| Boling Point | 700.8±60.0 °C(Predicted) |
| Flash Point | 377.7°C |
| Solubility | DMSO (Slightly) Methanol (Slightly, Heated) |
| Vapor Presure | 1.29E-20mmHg at 25°C |
| Appearance | Solid |
| Color | Off-White to Pale Grey |
| pKa | 12.77±0.70(Predicted) |
| Storage Condition | Sealed in dry,2-8°C |
| Refractive Index | 1.629 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| HS Code | 29329990 |