103796-34-5 - Names and Identifiers
| Name | 4,5-Diethoxy-2-nitrobenzoic acid
|
| Synonyms | 4,5-Diethoxy-2-nitrobenzoic acid 4,5-Diethoxy-2-nitro benzoic acid 4,5-DIETHOXY-2-NITRO BENZOIC ACID Benzoic acid, 4,5-diethoxy-2-nitro-
|
| CAS | 103796-34-5
|
| InChI | InChI=1/C11H13NO6/c1-3-17-9-5-7(11(13)14)8(12(15)16)6-10(9)18-4-2/h5-6H,3-4H2,1-2H3,(H,13,14) |
103796-34-5 - Physico-chemical Properties
| Molecular Formula | C11H13NO6
|
| Molar Mass | 255.22 |
| Density | 1.310 |
| Melting Point | 142-145 ºC |
| Boling Point | 424.826°C at 760 mmHg |
| Flash Point | 210.728°C |
| Vapor Presure | 0mmHg at 25°C |
| Refractive Index | 1.553 |
103796-34-5 - Introduction
4,5-diethoxy-2-nitrobenzoic acid is an organic compound with the chemical formula C12H15NO6. The following is a description of its nature, use, formulation and safety information:
Nature:
-Appearance: 4,5-diethoxy-2-nitrobenzoic acid is a white crystalline solid.
-Melting point: Its melting point is 75-79 degrees Celsius.
-Solubility: It is easily soluble in ethanol and chloroform, but less soluble in water.
Use:
-4,5-diethoxy-2-nitrobenzoic acid is mainly used as an intermediate in organic synthesis.
-It can be used to synthesize organic compounds such as pesticides, medicines and dyes.
Preparation Method:
-4,5-diethoxy-2-nitrobenzoic acid can be obtained by ethanol esterification of p-nitrobenzoic acid.
-The specific preparation method can use an oxidizing agent to react nitrobenzoic acid and ethanol to form 4,5-diethoxy -2-nitrobenzoic acid.
Safety Information:
-4,5-diethoxy-2-nitrobenzoic acid should be considered a toxic compound.
-Take appropriate personal protective measures during operation, such as wearing gloves, goggles, etc.
-Avoid inhaling its dust or contact with skin and eyes.
-When using or storing, keep it away from fire sources and flammable substances to prevent fire or explosion.
Last Update:2024-04-09 02:00:40