| Name | 1,4-dibutoxybenzene |
| Synonyms | 104-36-9 Pramoxine-006 P-DIBUTOXYBENZENE p-Dibutoxybenzene 1,4-dibutoxybenzene 1,4-Dibutoxybenzene 1,4-DIBUTOXYBENZENE Benzene, p-dibutoxy- 1,4-(DIBUTYLOXY)BENZENE Hydroquinone dibutyl ether 1-(3,3,5-triphenyl-2-pyrrolyl)isoquinoline |
| CAS | 104-36-9 |
| EINECS | 203-196-8 |
| InChI | InChI=1/C14H22O2/c1-3-5-11-15-13-7-9-14(10-8-13)16-12-6-4-2/h7-10H,3-6,11-12H2,1-2H3 |
| Molecular Formula | C14H22O2 |
| Molar Mass | 222.32 |
| Density | 0.9906 (rough estimate) |
| Melting Point | 45 °C |
| Boling Point | 158 °C / 15mmHg |
| Flash Point | 110.8°C |
| Solubility | soluble in Methanol |
| Vapor Presure | 0.00109mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Almost white |
| Storage Condition | 2-8℃ |
| Refractive Index | 1.4970 (estimate) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |