| Name | 3,5-diiodo-L-thyronine |
| Synonyms | diiodothyronine L-Diiodothyronine Diiodo-L-thyronine 3,5-diiodothyronine L-3,5-Diiodothyronine 3,5-Diiodi-L-thyronine 3,5-diiodo-L-thyronine 3-5-diiodo-L-thyronine crystalline O-(4-hydroxyphenyl)-3,5-diiodotyrosine O-(4-HYDROXYPHENYL)-3,5-DIIODO-L-TYROSINE 3,5-Diiodo-O-(4-hydroxyphenyl)-L-tyrosine L-TYROSINE, O-(4-HYDROXYPHENYL)-3,5-DIIODO- 3,5-DIIODO-4-(4-HYDROXYPHENOXY)-L-PHENYLALANINE 3-[4-p-[Hydroxyphenoxy]-3,5-diiodophenyl] alanine Alanine, 3-[4-(p-hydroxyphenoxy)-3,5-diiodophenyl]-, L- (2S)-2-amino-3-[4-(4-hydroxyphenoxy)-3,5-diiodo-phenyl]propanoic acid 3,5-Diiodo-4-(4-hydroxyphenoxy)-L-phenylalanine, O-(4-Hydroxyphenyl)-3,5-diiodo-L-tyrosine |
| CAS | 1041-01-6 |
| EINECS | 213-867-7 |
| InChI | InChI=1/C15H13I2NO4/c16-11-5-8(7-13(18)15(20)21)6-12(17)14(11)22-10-3-1-9(19)2-4-10/h1-6,13,19H,7,18H2,(H,20,21) |
| InChIKey | ZHSOTLOTTDYIIK-ZDUSSCGKSA-N |
| Molecular Formula | C15H13I2NO4 |
| Molar Mass | 525.08 |
| Density | 2.095±0.06 g/cm3(Predicted) |
| Melting Point | 255-260°C (dec.) |
| Boling Point | 559.4±50.0 °C(Predicted) |
| Flash Point | 292.1°C |
| Water Solubility | 20.147mg/L at 20℃ |
| Solubility | Acidic Alcohol (Slightly), Aqueous Base (Slightly) |
| Vapor Presure | 0.011Pa at 45℃ |
| Appearance | grayish white solid |
| Color | White to Light Brown |
| BRN | 2707891 |
| pKa | 2.15±0.30(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Store in freezer, under -20°C |
| Stability | Hygroscopic |
| Refractive Index | 1.726 |
| MDL | MFCD00064987 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | 22 - Harmful if swallowed |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 8 |
| HS Code | 29225090 |
| LogP | 1.1 at 25℃ |
| Biological activity | 3,5-diiodo-L-thyronine (3,5-T2, NSC 90469) is an endogenous metabolite of thyroid hormone. 3,5-Diiodo-l-thyronine is a potential hypolipidemic agent for the treatment of obesity and hepatic steatosis. |