| Name | 4-(PHTHALIMIDO)-CYCLOHEXANONE |
| Synonyms | 4-(PHTHALIMIDO)-CYCLOHEXANONE 4-(phthaliMide)-cyclohexanone 4-(phthalimide)-cyclohexanone N-(4-Oxocyclohexyl)phthalimide 2-(4-oxocyclohexyl)isoindoline-1,3-dione 2-(4-Oxo-cyclohexyl)-isoindole-1,3-dione 2-(4-Oxocyclohexyl)-1H-isoindole-1,3(2H)-dione 1H-Isoindole-1,3(2H)-dione,2-(4-oxocyclohexyl)- 1H-isoindole-1,3(2H)-dione, 2-(4-oxocyclohexyl)- |
| CAS | 104618-32-8 |
| EINECS | 1533716-785-6 |
| InChI | InChI=1/C14H13NO3/c16-10-7-5-9(6-8-10)15-13(17)11-3-1-2-4-12(11)14(15)18/h1-4,9H,5-8H2 |
| Molecular Formula | C14H13NO3 |
| Molar Mass | 243.26 |
| Density | 1.357 |
| Melting Point | 142.0 to 146.0 °C |
| Boling Point | 410.0±38.0 °C(Predicted) |
| Flash Point | 191.122°C |
| Vapor Presure | 0mmHg at 25°C |
| Appearance | powder to crystal |
| Color | White to Almost white |
| pKa | -2.27±0.20(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.627 |
| MDL | MFCD00158659 |