| Name | N,N,N'-Triethylethylenediamine |
| Synonyms | N,N,N'-Triethylethylenediamine n,n,n'-triethyl-2-ethanediamine diethyl(2-ethylaminoethyl)amine N,N,N'-Triethyl-1,2-ethanediamine N,N,N'-triethylethane-1,2-diamine Ethylenediamine, N,N,N'-triethyl- N,N,N'-triethylethane-1,2-diaminium 1,2-Ethanediamine,N1,N1,N2-triethyl- |
| CAS | 105-04-4 |
| EINECS | 203-264-7 |
| InChI | InChI=1/C8H20N2/c1-4-9-7-8-10(5-2)6-3/h9H,4-8H2,1-3H3/p+2 |
| Molecular Formula | C8H20N2 |
| Molar Mass | 144.26 |
| Density | 0.804g/mLat 25°C(lit.) |
| Melting Point | 52°C (estimate) |
| Boling Point | 54-55°C13mm Hg(lit.) |
| Flash Point | 90°F |
| Vapor Presure | 2.3mmHg at 25°C |
| Appearance | Liquid |
| Color | Clear colorless to slightly yellow |
| pKa | 10?+-.0.25(Predicted) |
| Storage Condition | Flammables area |
| Refractive Index | n20/D 1.4311(lit.) |
| MDL | MFCD00009054 |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | R10 - Flammable R34 - Causes burns |
| Safety Description | S16 - Keep away from sources of ignition. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S27 - Take off immediately all contaminated clothing. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 2734 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 29212900 |
| Hazard Class | 8 |
| Packing Group | II |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |