| Name | 1,4-benzenedimethanethiol |
| Synonyms | 1,4-BENZENEDIMETHANE 1,4-benzenedimethanethiol 1,4-Benzene dimethanethiol 1,4-Benzene dimathanethiol 1,4-phenylenediMethanethiol alpha,alpha'-p-Xylenedithiol p-xylene-alpha,alpha-dithiol 1,4-Bis(mercaptomethyl)benzene benzene-1,4-diyldimethanethiol 4-(Sulfanylmethyl)benzyl hydrosulfide [4-(sulfanylmethyl)phenyl]methanethiol [4-(mercaptomethyl)phenyl]methanethiol alpha,alpha'-Dimercapto-p-xylene1,4-Benzenedimethanethiol |
| CAS | 105-09-9 |
| EINECS | 203-269-4 |
| InChI | InChI=1/C8H10S2/c9-5-7-1-2-8(6-10)4-3-7/h1-4,9-10H,5-6H2 |
| InChIKey | IYPNRTQAOXLCQW-UHFFFAOYSA-N |
| Molecular Formula | C8H10S2 |
| Molar Mass | 170.29 |
| Density | 1.1604 (rough estimate) |
| Melting Point | 45-46 °C (lit.) |
| Boling Point | 156 °C/12 mmHg (lit.) |
| Flash Point | >230°F |
| Vapor Presure | 0.00327mmHg at 25°C |
| Appearance | White solid or powder |
| Color | White to Almost white |
| pKa | 9.41±0.10(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.6210 (estimate) |
| MDL | MFCD00004872 |
| Physical and Chemical Properties | Light yellow crystals. Melting point 45-46 °c. |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S37/39 - Wear suitable gloves and eye/face protection |
| UN IDs | UN 3335 |
| WGK Germany | 3 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| application | 1, 4-benzenedimethyl mercaptan can be used as an organic synthesis intermediate and a pharmaceutical intermediate, mainly used in laboratory research and development processes and chemical production processes. |