| Name | 5,6,7,8-TETRAHYDROQUINOLINE |
| Synonyms | 2,3-CYCLOHEXENO PYRIDINE 2,3-CYCLOHEXANO PYRIDINE 2,3-cyclohexeno pyridine 5,6,7,8-TETRAHYDROQUINOLINE quinoline,5,6,7,8-tetrahydro- 5,6,7,8- fourhydrogenation ofquinoline |
| CAS | 10500-57-9 |
| EINECS | 234-030-2 |
| InChI | InChI=1/C9H11N/c1-2-6-9-8(4-1)5-3-7-10-9/h3,5,7H,1-2,4,6H2 |
| Molecular Formula | C9H11N |
| Molar Mass | 133.19 |
| Density | 1,08 g/cm3 |
| Boling Point | 238°C |
| Flash Point | 90°C |
| Solubility | Chloroform (Slightly), DMSO (Sparingly) Methanol (Slightly) |
| Appearance | Oil |
| Specific Gravity | 1.0341.0304 (20/4℃) |
| Color | Colourless |
| pKa | 6.30±0.20(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.5420 to 1.5450 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S37/39 - Wear suitable gloves and eye/face protection |
| HS Code | 29334900 |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| Use | intermediate of cefquinome. |