| Name | 5-Chloroindole-2-carboxylic acid |
| Synonyms | 5-Cl-ICA TIMTEC-BB SBB003591 5-CHLORO-2-INDOLECARBOXYLATE 5-chloroindole-2-carboxylate 5-CHLORO-2-INDOLECARBOXYLIC ACID 5-chloro-1H-indole-2-carboxylate 5-Chloroindole-2-carboxylic acid 5-Chloro-1H-indole-2-carboxylic acid 5-Chloroindole-2-carboxylic acid in stock Factory |
| CAS | 10517-21-2 |
| EINECS | 234-050-1 |
| InChI | InChI=1/C9H6ClNO2/c10-6-1-2-7-5(3-6)4-8(11-7)9(12)13/h1-4,11H,(H,12,13)/p-1 |
| InChIKey | FUQOTYRCMBZFOL-UHFFFAOYSA-N |
| Molecular Formula | C9H6ClNO2 |
| Molar Mass | 195.6 |
| Density | 1.3228 (rough estimate) |
| Melting Point | 287 °C (dec.) (lit.) |
| Boling Point | 449.7±25.0 °C(Predicted) |
| Flash Point | 225.8°C |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 7.12E-09mmHg at 25°C |
| Appearance | Almost white powder |
| Color | Beige |
| BRN | 153229 |
| pKa | 4.26±0.30(Predicted) |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.5790 (estimate) |
| MDL | MFCD00005613 |
| Risk Codes | R22 - Harmful if swallowed R36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. S37/39 - Wear suitable gloves and eye/face protection |
| WGK Germany | 3 |
| RTECS | NL5998400 |
| HS Code | 29339990 |
| Hazard Class | IRRITANT |
| application | 5-chloroindole-2-carboxylic acid can be used as several synthetic intermediates and pharmaceutical intermediates, mainly used in laboratory research and development process and pharmaceutical and chemical production process. |