| Name | 9,9'-Bianthracene |
| Synonyms | AI3-19380 bianthryl bianthracene 9,9'-bianthryl 9,9'-Bianthryl 9,9'-Bianthranyl 9,9'-Bianthracene 9,9'-Dianthracene 9,9'-Bianthracenyl 9-(9-Anthryl)anthracene |
| CAS | 1055-23-8 |
| EINECS | 1592732-453-0 |
| InChI | InChI=1/C28H18/c1-5-13-23-19(9-1)17-20-10-2-6-14-24(20)27(23)28-25-15-7-3-11-21(25)18-22-12-4-8-16-26(22)28/h1-18H |
| Molecular Formula | C28H18 |
| Molar Mass | 354.44 |
| Density | 1.1633 (estimate) |
| Melting Point | >300°C |
| Boling Point | 422.66°C (rough estimate) |
| Flash Point | 268.2°C |
| Vapor Presure | 1.53E-10mmHg at 25°C |
| Appearance | Pale yellow flake crystal |
| Color | Light yellow to Yellow to Green |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.8430 (estimate) |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| RTECS | DT3572500 |
| HS Code | 29029090 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |