| Name | 4-Bromo-3,5-dimethylisoxazole |
| Synonyms | TIMTEC-BB SBB003784 4-Bromo-dimethylisoxazole 4-Bromo-3,5-dimethylisoxa... 4-BROMO-3,5-DIMETHYLISOXAZOLE 4-Bromo-3,5-dimethylisoxazole 3,5-Dimethyl-4-bromoisoxazole Isoxazole, 4-broMo-3,5-diMethyl- 4-bromo-3,5-dimethyl-1,2-oxazole 4-Bromo-3,5-dimethylisoxazole, tech. |
| CAS | 10558-25-5 |
| EINECS | 000-000-0 |
| InChI | InChI=1/C5H6BrNO/c1-3-5(6)4(2)8-7-3/h1-2H3 |
| Molecular Formula | C5H6BrNO |
| Molar Mass | 176.01 |
| Density | 1.478g/mLat 25°C(lit.) |
| Melting Point | 176 °C(lit.) |
| Boling Point | 176°C(lit.) |
| Flash Point | >230°F |
| Vapor Presure | 0.219mmHg at 25°C |
| Appearance | Transparent to yellow liquid |
| Color | Colorless to Light orange to Yellow |
| BRN | 108522 |
| pKa | -2.35±0.28(Predicted) |
| Storage Condition | 2-8°C |
| Sensitive | Light Sensitive |
| Refractive Index | n20/D 1.486(lit.) |
| MDL | MFCD00068187 |
| Physical and Chemical Properties | Keep Cold/Light Sensitive |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Hazard Note | Keep Cold/Light Sensitive |
| application | 4-bromo-3, 5-dimethylisoxazole is a pharmaceutical intermediate that can be used to prepare phenoxyacetic acid derivatives with excellent GPR40 agonistic activity and hypoglycemic activity in vivo. There are also reports that it can be used to prepare mono-heterocyclic boric acid such as 3, 5-dimethyl-4-isoxazole boric acid. |