| Name | (R)-2-acetamido-3-O-(1-carboxyethyl)-2-deoxy-D-glucose |
| Synonyms | NAMA MURNAC AC-MURAMIC ACID N-ACETYLMURAMIC ACID (R)-2-acetamido-3-O-(1-carboxyethyl)-2-deoxy-D-glucose (R)-2-(ACETYLAMINO)-3-O-(1-CARBOXYETHYL)-2-DEOXY-D-GLUCOSE (2R)-2-[[(2S,3R,4R,5S,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)-4-oxanyl]oxy]propanoate MurNAc, NAMA, (R)-2-(Acetylamino)-3-O-(1-carboxyethyl)-2-deoxy-D-glucose, 2-Acetamido-2-deoxy-3-O-(D-1-carboxyethyl)-D-glucopyranose |
| CAS | 10597-89-4 |
| EINECS | 234-214-2 |
| InChI | InChI=1/C11H19NO8/c1-4(10(16)17)19-9-7(12-5(2)14)11(18)20-6(3-13)8(9)15/h4,6-9,11,13,15,18H,3H2,1-2H3,(H,12,14)(H,16,17)/p-1/t4-,6-,7-,8-,9-,11+/m1/s1 |
| Molecular Formula | C11H19NO8 |
| Molar Mass | 293.27 |
| Density | 1.3224 (rough estimate) |
| Melting Point | 125°C (dec.)(lit.) |
| Boling Point | 435.13°C (rough estimate) |
| Specific Rotation(α) | D20 +56° (10 minutes) +40° (24 hrs) (c = 0.68 in water) |
| Flash Point | 375.02°C |
| Vapor Presure | 0mmHg at 25°C |
| Appearance | White powder |
| Merck | 13,6328 |
| BRN | 1994245 |
| pKa | 3.25±0.10(Predicted) |
| Storage Condition | 2-8°C |
| Refractive Index | 1.4450 (estimate) |
| MDL | MFCD00221511 |
| Risk Codes | R20/21/22 - Harmful by inhalation, in contact with skin and if swallowed. R68/20/21/22 - R39/23/24/25 - |
| Safety Description | S36/37 - Wear suitable protective clothing and gloves. S35 - This material and its container must be disposed of in a safe way. S22 - Do not breathe dust. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 3-10 |
| HS Code | 29329990 |