| Name | 4-Bromo-6-chloronicotinaldehyde |
| Synonyms | 4-broMo-6-chloronicotinaldehyde 4-Bromo-6-chloronicotinaldehyde 4-Bromo-6-chloropyridine-3-carbaldehyde 3-Pyridinecarboxaldehyde, 4-bromo-6-chloro- |
| CAS | 1060805-64-2 |
| InChI | InChI=1S/C6H3BrClNO/c7-5-1-6(8)9-2-4(5)3-10/h1-3H |
| Molecular Formula | C6H3BrClNO |
| Molar Mass | 220.45 |
| Density | 1.800±0.06 g/cm3(Predicted) |
| Boling Point | 298.3±35.0 °C(Predicted) |
| pKa | -1.75±0.10(Predicted) |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Overview | 4-bromo-6-chloronicotine is an aldehyde compound, which is an intermediate for the preparation of selective inhibitors of FGFR4 enzyme (tyrosine kinase). FGFR4 enzyme (tyrosine kinase) selective inhibitor for the treatment of diseases caused by FGFR4 or FGF19. FGFR4 has a significant selective inhibitory effect and has broad application prospects in the treatment of liver cancer, gastric cancer, renal cell carcinoma, sarcoma, cholangiocarcinoma, colon cancer, prostate cancer, ovarian cancer and breast cancer. |
| use | 4-bromo-6-chloronicotine is an important intermediate of FGFR4 enzyme selective inhibitor. |