| Name | 2-Amino-5-methyl-1,3,4-thiadiazole |
| Synonyms | usafcy-3 TOSLAB 27625 VITAS-BB TBB000116 TIMTEC-BB SBB000045 4-thiadiazol-2-amine,5-methyl-3 4-thiadiazole,2-amino-5-methyl-3 5-Methyl-1,3,4-thiadiazol-2-amine 3-methyl-1H-1,2,4-triazol-5-amine 2-Amino-5-methyl-1,3,4-thiadiazole 5-methyl-1,3,4-thiadiazole-2-amine 5-Methyl-1,3,4-thiadiazol-2-ylamine 1,3,4-Thiadiazole, 2-amino-5-methyl. |
| CAS | 108-33-8 |
| EINECS | 203-573-7 |
| InChI | InChI=1/C3H6N4/c1-2-5-3(4)7-6-2/h1H3,(H3,4,5,6,7) |
| InChIKey | HMPUHXCGUHDVBI-UHFFFAOYSA-N |
| Molecular Formula | C3H5N3S |
| Molar Mass | 115.16 |
| Density | 1.287 (estimate) |
| Melting Point | 223-228 °C |
| Boling Point | 261.2±23.0 °C(Predicted) |
| Flash Point | 189.6°C |
| Solubility | DMSO (Sparingly), Methanol (Slightly) |
| Vapor Presure | 6.12E-05mmHg at 25°C |
| Appearance | White powder |
| Color | Off-White |
| pKa | 3.84±0.10(Predicted) |
| Storage Condition | Keep in dark place,Inert atmosphere,Room temperature |
| Refractive Index | 1.5800 (estimate) |
| MDL | MFCD00003110 |
| Physical and Chemical Properties | Beige solid powder, melting point 220~225 ℃ (decomposition). |
| Use | For dyes, and the synthesis of azole drugs |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S24/25 - Avoid contact with skin and eyes. S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| RTECS | XI3500000 |
| HS Code | 29349990 |
| Hazard Note | Irritant |
| Use | 2-amino -5-methyl -1,3,4-thiadiazole is used to synthesize substituted 5H-benzo [I][1,3,4] thiadiazole [3,2-] quinazoline -6,7-diketone compound reagent, has good cytotoxic activity. It is also used in the design of new phenothiazine-thiadiazole hybrids to develop anti-tuberculosis drugs. Used in the synthesis of dyes and azole drugs. |