| Name | 4,4'-bis(2-(1-propenyl)phenoxy)benzo-phenone |
| Synonyms | 4,4'-Bis[2-(1-Propenyl)Phenoxy]Benzophenone 4,4'-BIS[2-(1-PROPENYL)PHENOXY]BENZOPHENONE bis[4-(2-prop-1-enylphenoxy)phenyl]methanone 4,4'-bis(2-(1-propenyl)phenoxy)benzo-phenone bis[4-[2-(1-propenyl)phenoxy]phenyl]-methanon Methanone, bis(4-(2-(1-propenyl)phenoxy)phenyl)- Methanone, bis(4-(2-(1-propen-1-yl)phenoxy)phenyl)- 4,4-Bis[2-(1-propenyl)phenoxy]benzophenone,mixture of cis and trans |
| CAS | 109423-33-8 |
| InChI | InChI=1/C31H26O3/c1-21(2)27-9-5-7-11-29(27)33-25-17-13-23(14-18-25)31(32)24-15-19-26(20-16-24)34-30-12-8-6-10-28(30)22(3)4/h5-20H,1,3H2,2,4H3 |
| Molecular Formula | C31H26O3 |
| Molar Mass | 446.54 |
| Density | 1.143±0.06 g/cm3(Predicted) |
| Melting Point | 43-45°C(lit.) |
| Boling Point | 576.6±50.0 °C(Predicted) |
| Flash Point | 287.7°C |
| Vapor Presure | 9.66E-13mmHg at 25°C |
| Storage Condition | 2-8°C |
| Refractive Index | 1.602 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |