| Name | 1-Bromo-2-chloro-4-fluorobenzene |
| Synonyms | 3-Chloro-4-bromofluorobenzene 2-Bromo-5-fluorochlorobenzene 2-CHLORO-4-FLUOROBROMOBENZENE 4-Bromo-3-chlorofluorobenzene 1-Bromo-2-chloro-4-fluorobenzene 1-BROMO-2-CHLORO-4-FLUOROBENZENE 4-BROMO-3-CHLORO-1-FLUOROBENZENE |
| CAS | 110407-59-5 |
| InChI | InChI=1/C6H3BrClF/c7-5-2-1-4(9)3-6(5)8/h1-3H |
| InChIKey | LEFQPBAWVJEIJS-UHFFFAOYSA-N |
| Molecular Formula | C6H3BrClF |
| Molar Mass | 209.44 |
| Density | 1.75 |
| Boling Point | 62-62.8 °C(Press: 12 Torr) |
| Flash Point | 72.5°C |
| Vapor Presure | 0.564mmHg at 25°C |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.5525 |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R36 - Irritating to the eyes R22 - Harmful if swallowed |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S37 - Wear suitable gloves. |
| HS Code | 29039990 |
| Hazard Note | Irritant |